C10H11NO7 — CID 86595511
dimethyl 2-hydroxy-4-nitrocyclohexa-1,5-diene-1,4-dicarboxylate (PubChem CID 86595511) has the molecular formula C10H11NO7 and a molecular weight of 257.20 g/mol. Its IUPAC name is dimethyl 2-hydroxy-4-nitrocyclohexa-1,5-diene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-hydroxy-4-nitrocyclohexa-1,5-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 86595511 |
| Molecular Formula | C10H11NO7 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | dimethyl 2-hydroxy-4-nitrocyclohexa-1,5-diene-1,4-dicarboxylate |
| SMILES | COC(=O)C1=C(O)CC(C(=O)OC)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C10H11NO7/c1-17-8(13)6-3-4-10(11(15)16,5-7(6)12)9(14)18-2/h3-4,12H,5H2,1-2H3 |
| InChIKey | PAIQVDDUSVWFRN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|