C9H12FeN2O4 — CID 174898007
1-(1-amino-4-methoxy-5-nitrocyclohexa-2,4-dien-1-yl)ethanone;iron (PubChem CID 174898007) has the molecular formula C9H12FeN2O4 and a molecular weight of 268.05 g/mol. Its IUPAC name is 1-(1-amino-4-methoxy-5-nitrocyclohexa-2,4-dien-1-yl)ethanone;iron.
| Compound Name | 1-(1-amino-4-methoxy-5-nitrocyclohexa-2,4-dien-1-yl)ethanone;iron |
|---|---|
| PubChem CID | 174898007 |
| Molecular Formula | C9H12FeN2O4 |
| Molecular Weight | 268.05 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 1-(1-amino-4-methoxy-5-nitrocyclohexa-2,4-dien-1-yl)ethanone;iron |
| SMILES | COC1=C([N+](=O)[O-])CC(N)(C(C)=O)C=C1.[Fe] |
| InChI | InChI=1S/C9H12N2O4.Fe/c1-6(12)9(10)4-3-8(15-2)7(5-9)11(13)14;/h3-4H,5,10H2,1-2H3; |
| InChIKey | OWGYKRHGHTUMOX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.05 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|