C8H8N2O6 — CID 156777486
4-amino-5-methoxy-3-nitro-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 156777486) has the molecular formula C8H8N2O6 and a molecular weight of 228.16 g/mol. Its IUPAC name is 4-amino-5-methoxy-3-nitro-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
| Compound Name | 4-amino-5-methoxy-3-nitro-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 156777486 |
| Molecular Formula | C8H8N2O6 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-amino-5-methoxy-3-nitro-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | COC1=C(N)C([N+](=O)[O-])=CC2(C(=O)O)OC12 |
| InChI | InChI=1S/C8H8N2O6/c1-15-5-4(9)3(10(13)14)2-8(7(11)12)6(5)16-8/h2,6H,9H2,1H3,(H,11,12) |
| InChIKey | FOUXJZDBWSWVJG-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|