C26H22N2O4 — CID 171904983
[4-(4-methoxyphenyl)-2-methyl-5-nitro-6-phenyl-1,4-dihydropyridin-3-yl]-phenylmethanone (PubChem CID 171904983) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-2-methyl-5-nitro-6-phenyl-1,4-dihydropyridin-3-yl]-phenylmethanone.
| Compound Name | [4-(4-methoxyphenyl)-2-methyl-5-nitro-6-phenyl-1,4-dihydropyridin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 171904983 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [4-(4-methoxyphenyl)-2-methyl-5-nitro-6-phenyl-1,4-dihydropyridin-3-yl]-phenylmethanone |
| SMILES | COc1ccc(C2C(C(=O)c3ccccc3)=C(C)NC(c3ccccc3)=C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H22N2O4/c1-17-22(26(29)20-11-7-4-8-12-20)23(18-13-15-21(32-2)16-14-18)25(28(30)31)24(27-17)19-9-5-3-6-10-19/h3-16,23,27H,1-2H3 |
| InChIKey | UESTUPLNGZFBKJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|