C31H28N2O6 — CID 2864981
benzyl 7-(4-methoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 2864981) has the molecular formula C31H28N2O6 and a molecular weight of 524.57 g/mol. Its IUPAC name is benzyl 7-(4-methoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | benzyl 7-(4-methoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 2864981 |
| Molecular Formula | C31H28N2O6 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | benzyl 7-(4-methoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc(C2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCc2ccccc2)C3c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C31H28N2O6/c1-19-28(31(35)39-18-20-7-4-3-5-8-20)29(22-9-6-10-24(15-22)33(36)37)30-26(32-19)16-23(17-27(30)34)21-11-13-25(38-2)14-12-21/h3-15,23,29,32H,16-18H2,1-2H3 |
| InChIKey | FFFCOIFKBQTWQU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|