C32H29NO6 — CID 1007712
benzyl (4S,7R)-4-(1,3-benzodioxol-5-yl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1007712) has the molecular formula C32H29NO6 and a molecular weight of 523.59 g/mol. Its IUPAC name is benzyl (4S,7R)-4-(1,3-benzodioxol-5-yl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | benzyl (4S,7R)-4-(1,3-benzodioxol-5-yl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1007712 |
| Molecular Formula | C32H29NO6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | benzyl (4S,7R)-4-(1,3-benzodioxol-5-yl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCc2ccccc2)[C@H]3c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C32H29NO6/c1-19-29(32(35)37-17-20-6-4-3-5-7-20)30(22-10-13-27-28(16-22)39-18-38-27)31-25(33-19)14-23(15-26(31)34)21-8-11-24(36-2)12-9-21/h3-13,16,23,30,33H,14-15,17-18H2,1-2H3/t23-,30-/m1/s1 |
| InChIKey | XZQVKCKCZMCGHC-WVXBCFDCSA-N |
| XLogP | 5.53 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |