C33H33NO6 — CID 1113418
benzyl (4S,7S)-4-(2,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1113418) has the molecular formula C33H33NO6 and a molecular weight of 539.63 g/mol. Its IUPAC name is benzyl (4S,7S)-4-(2,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | benzyl (4S,7S)-4-(2,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1113418 |
| Molecular Formula | C33H33NO6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | benzyl (4S,7S)-4-(2,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCc2ccccc2)[C@H]3c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C33H33NO6/c1-20-30(33(36)40-19-21-8-6-5-7-9-21)31(26-15-14-25(38-3)18-29(26)39-4)32-27(34-20)16-23(17-28(32)35)22-10-12-24(37-2)13-11-22/h5-15,18,23,31,34H,16-17,19H2,1-4H3/t23-,31+/m0/s1 |
| InChIKey | GPOALINDVRBIKG-GTYOFVGBSA-N |
| XLogP | 5.82 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |