C25H21N3O3 — CID 14998955
[2,6-dimethyl-4-(3-nitrophenyl)-5-pyridin-3-yl-1,4-dihydropyridin-3-yl]-phenylmethanone (PubChem CID 14998955) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2,6-dimethyl-4-(3-nitrophenyl)-5-pyridin-3-yl-1,4-dihydropyridin-3-yl]-phenylmethanone.
| Compound Name | [2,6-dimethyl-4-(3-nitrophenyl)-5-pyridin-3-yl-1,4-dihydropyridin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 14998955 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [2,6-dimethyl-4-(3-nitrophenyl)-5-pyridin-3-yl-1,4-dihydropyridin-3-yl]-phenylmethanone |
| SMILES | CC1=C(C(=O)c2ccccc2)C(c2cccc([N+](=O)[O-])c2)C(c2cccnc2)=C(C)N1 |
| InChI | InChI=1S/C25H21N3O3/c1-16-22(20-11-7-13-26-15-20)24(19-10-6-12-21(14-19)28(30)31)23(17(2)27-16)25(29)18-8-4-3-5-9-18/h3-15,24,27H,1-2H3 |
| InChIKey | MJNUTZGKXKVSGW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|