C24H21N5O4 — CID 10718095
ethyl 2-methyl-4-(3-nitrophenyl)-5-pyrazin-2-yl-6-pyridin-2-yl-1,4-dihydropyridine-3-carboxylate (PubChem CID 10718095) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is ethyl 2-methyl-4-(3-nitrophenyl)-5-pyrazin-2-yl-6-pyridin-2-yl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 2-methyl-4-(3-nitrophenyl)-5-pyrazin-2-yl-6-pyridin-2-yl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10718095 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | ethyl 2-methyl-4-(3-nitrophenyl)-5-pyrazin-2-yl-6-pyridin-2-yl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(c2ccccn2)=C(c2cnccn2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21N5O4/c1-3-33-24(30)20-15(2)28-23(18-9-4-5-10-26-18)22(19-14-25-11-12-27-19)21(20)16-7-6-8-17(13-16)29(31)32/h4-14,21,28H,3H2,1-2H3 |
| InChIKey | LUGQKNMPZXVSHS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|