C30H24N2O4 — CID 171905022
[4-(4-methoxyphenyl)-2-methyl-5-nitro-6-phenyl-1,4-dihydropyridin-3-yl]-naphthalen-1-ylmethanone (PubChem CID 171905022) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-2-methyl-5-nitro-6-phenyl-1,4-dihydropyridin-3-yl]-naphthalen-1-ylmethanone.
| Compound Name | [4-(4-methoxyphenyl)-2-methyl-5-nitro-6-phenyl-1,4-dihydropyridin-3-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 171905022 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [4-(4-methoxyphenyl)-2-methyl-5-nitro-6-phenyl-1,4-dihydropyridin-3-yl]-naphthalen-1-ylmethanone |
| SMILES | COc1ccc(C2C(C(=O)c3cccc4ccccc34)=C(C)NC(c3ccccc3)=C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H24N2O4/c1-19-26(30(33)25-14-8-12-20-9-6-7-13-24(20)25)27(21-15-17-23(36-2)18-16-21)29(32(34)35)28(31-19)22-10-4-3-5-11-22/h3-18,27,31H,1-2H3 |
| InChIKey | YXLVODPPKSLZLE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|