C31H25N2O4+ — CID 171905058
[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]-naphthalen-1-ylmethanone (PubChem CID 171905058) has the molecular formula C31H25N2O4+ and a molecular weight of 489.55 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]-naphthalen-1-ylmethanone.
| Compound Name | [4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 171905058 |
| Molecular Formula | C31H25N2O4+ |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | [4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]-naphthalen-1-ylmethanone |
| SMILES | COc1ccc(-c2c(C(=O)c3cccc4ccccc34)c(C)[n+](C)c(-c3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H25N2O4/c1-20-27(31(34)26-15-9-13-21-10-7-8-14-25(21)26)28(22-16-18-24(37-3)19-17-22)30(33(35)36)29(32(20)2)23-11-5-4-6-12-23/h4-19H,1-3H3/q+1 |
| InChIKey | YTDPLSLJOFXVTK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 73.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|