C26H22ClN3O7 — CID 171905028
1,2-dimethyl-5-nitro-N,4,6-triphenylpyridin-1-ium-3-carboxamide perchlorate (PubChem CID 171905028) has the molecular formula C26H22ClN3O7 and a molecular weight of 523.93 g/mol. Its IUPAC name is 1,2-dimethyl-5-nitro-N,4,6-triphenylpyridin-1-ium-3-carboxamide perchlorate.
| Compound Name | 1,2-dimethyl-5-nitro-N,4,6-triphenylpyridin-1-ium-3-carboxamide perchlorate |
|---|---|
| PubChem CID | 171905028 |
| Molecular Formula | C26H22ClN3O7 |
| Molecular Weight | 523.93 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 1,2-dimethyl-5-nitro-N,4,6-triphenylpyridin-1-ium-3-carboxamide perchlorate |
| SMILES | Cc1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c([N+](=O)[O-])c(-c2ccccc2)[n+]1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C26H21N3O3.ClHO4/c1-18-22(26(30)27-21-16-10-5-11-17-21)23(19-12-6-3-7-13-19)25(29(31)32)24(28(18)2)20-14-8-4-9-15-20;2-1(3,4)5/h3-17H,1-2H3;(H,2,3,4,5) |
| InChIKey | ALXADGMIESOJQR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 168.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.93 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|