C24H23ClN2O8 — CID 171905015
cyclopropyl-[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]methanone perchlorate (PubChem CID 171905015) has the molecular formula C24H23ClN2O8 and a molecular weight of 502.91 g/mol. Its IUPAC name is cyclopropyl-[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]methanone perchlorate.
| Compound Name | cyclopropyl-[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]methanone perchlorate |
|---|---|
| PubChem CID | 171905015 |
| Molecular Formula | C24H23ClN2O8 |
| Molecular Weight | 502.91 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | cyclopropyl-[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]methanone perchlorate |
| SMILES | COc1ccc(-c2c(C(=O)C3CC3)c(C)[n+](C)c(-c3ccccc3)c2[N+](=O)[O-])cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H23N2O4.ClHO4/c1-15-20(24(27)18-9-10-18)21(16-11-13-19(30-3)14-12-16)23(26(28)29)22(25(15)2)17-7-5-4-6-8-17;2-1(3,4)5/h4-8,11-14,18H,9-10H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | UYCYVSGPZZBRDB-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 165.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.91 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|