C27H22BrN2O4+ — CID 171905041
(4-bromophenyl)-[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]methanone (PubChem CID 171905041) has the molecular formula C27H22BrN2O4+ and a molecular weight of 518.39 g/mol. Its IUPAC name is (4-bromophenyl)-[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]methanone.
| Compound Name | (4-bromophenyl)-[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]methanone |
|---|---|
| PubChem CID | 171905041 |
| Molecular Formula | C27H22BrN2O4+ |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | (4-bromophenyl)-[4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-yl]methanone |
| SMILES | COc1ccc(-c2c(C(=O)c3ccc(Br)cc3)c(C)[n+](C)c(-c3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H22BrN2O4/c1-17-23(27(31)20-9-13-21(28)14-10-20)24(18-11-15-22(34-3)16-12-18)26(30(32)33)25(29(17)2)19-7-5-4-6-8-19/h4-16H,1-3H3/q+1 |
| InChIKey | RVGRHVWSZBNKRN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 73.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|