C27H22N2O4 — CID 171905001
(4-methoxyphenyl)-[6-(methylamino)-3-nitro-2,4-diphenylphenyl]methanone (PubChem CID 171905001) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is (4-methoxyphenyl)-[6-(methylamino)-3-nitro-2,4-diphenylphenyl]methanone.
| Compound Name | (4-methoxyphenyl)-[6-(methylamino)-3-nitro-2,4-diphenylphenyl]methanone |
|---|---|
| PubChem CID | 171905001 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (4-methoxyphenyl)-[6-(methylamino)-3-nitro-2,4-diphenylphenyl]methanone |
| SMILES | CNc1cc(-c2ccccc2)c([N+](=O)[O-])c(-c2ccccc2)c1C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H22N2O4/c1-28-23-17-22(18-9-5-3-6-10-18)26(29(31)32)24(19-11-7-4-8-12-19)25(23)27(30)20-13-15-21(33-2)16-14-20/h3-17,28H,1-2H3 |
| InChIKey | YMYCETQQJVQPNQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|