C27H24N3O4+ — CID 171905046
4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-N,6-diphenylpyridin-1-ium-3-carboxamide (PubChem CID 171905046) has the molecular formula C27H24N3O4+ and a molecular weight of 454.51 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-N,6-diphenylpyridin-1-ium-3-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-N,6-diphenylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 171905046 |
| Molecular Formula | C27H24N3O4+ |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-N,6-diphenylpyridin-1-ium-3-carboxamide |
| SMILES | COc1ccc(-c2c(C(=O)Nc3ccccc3)c(C)[n+](C)c(-c3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H23N3O4/c1-18-23(27(31)28-21-12-8-5-9-13-21)24(19-14-16-22(34-3)17-15-19)26(30(32)33)25(29(18)2)20-10-6-4-7-11-20/h4-17H,1-3H3/p+1 |
| InChIKey | ZSBZPOIXDBCUFT-UHFFFAOYSA-O |
| XLogP | 5.32 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|