C21H18N3O3+ — CID 171904977
4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-carbonitrile (PubChem CID 171904977) has the molecular formula C21H18N3O3+ and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-carbonitrile.
| Compound Name | 4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 171904977 |
| Molecular Formula | C21H18N3O3+ |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,2-dimethyl-5-nitro-6-phenylpyridin-1-ium-3-carbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(C)[n+](C)c(-c3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18N3O3/c1-14-18(13-22)19(15-9-11-17(27-3)12-10-15)21(24(25)26)20(23(14)2)16-7-5-4-6-8-16/h4-12H,1-3H3/q+1 |
| InChIKey | QGJVTFILGUNOLW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|