C17H12N4O4 — CID 10854314
5,7-dimethoxy-8-nitro-3-phenylquinoxaline-2-carbonitrile (PubChem CID 10854314) has the molecular formula C17H12N4O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 5,7-dimethoxy-8-nitro-3-phenylquinoxaline-2-carbonitrile.
| Compound Name | 5,7-dimethoxy-8-nitro-3-phenylquinoxaline-2-carbonitrile |
|---|---|
| PubChem CID | 10854314 |
| Molecular Formula | C17H12N4O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5,7-dimethoxy-8-nitro-3-phenylquinoxaline-2-carbonitrile |
| SMILES | COc1cc(OC)c2nc(-c3ccccc3)c(C#N)nc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12N4O4/c1-24-12-8-13(25-2)17(21(22)23)16-15(12)20-14(11(9-18)19-16)10-6-4-3-5-7-10/h3-8H,1-2H3 |
| InChIKey | FUVWKYMWSMFSGD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|