C7H8N4O8S — CID 88745764
6-methylsulfonyl-2,4,4-trinitrocyclohexa-1,5-dien-1-amine (PubChem CID 88745764) has the molecular formula C7H8N4O8S and a molecular weight of 308.23 g/mol. Its IUPAC name is 6-methylsulfonyl-2,4,4-trinitrocyclohexa-1,5-dien-1-amine.
| Compound Name | 6-methylsulfonyl-2,4,4-trinitrocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 88745764 |
| Molecular Formula | C7H8N4O8S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 6-methylsulfonyl-2,4,4-trinitrocyclohexa-1,5-dien-1-amine |
| SMILES | CS(=O)(=O)C1=CC([N+](=O)[O-])([N+](=O)[O-])CC([N+](=O)[O-])=C1N |
| InChI | InChI=1S/C7H8N4O8S/c1-20(18,19)5-3-7(10(14)15,11(16)17)2-4(6(5)8)9(12)13/h3H,2,8H2,1H3 |
| InChIKey | OKMUMZRPFGRIEC-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 189.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|