C7H6F3N3O4 — CID 88738014
2,4-dinitro-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (PubChem CID 88738014) has the molecular formula C7H6F3N3O4 and a molecular weight of 253.14 g/mol. Its IUPAC name is 2,4-dinitro-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
| Compound Name | 2,4-dinitro-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 88738014 |
| Molecular Formula | C7H6F3N3O4 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2,4-dinitro-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| SMILES | NC1=C([N+](=O)[O-])CC([N+](=O)[O-])(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C7H6F3N3O4/c8-7(9,10)6(13(16)17)2-1-4(11)5(3-6)12(14)15/h1-2H,3,11H2 |
| InChIKey | UQLLBCDNAPEUSW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|