C6H6N2O7S — CID 88694502
1,5-dinitrocyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 88694502) has the molecular formula C6H6N2O7S and a molecular weight of 250.19 g/mol. Its IUPAC name is 1,5-dinitrocyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 1,5-dinitrocyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 88694502 |
| Molecular Formula | C6H6N2O7S |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 1,5-dinitrocyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | O=[N+]([O-])C1=CC=CC([N+](=O)[O-])(S(=O)(=O)O)C1 |
| InChI | InChI=1S/C6H6N2O7S/c9-7(10)5-2-1-3-6(4-5,8(11)12)16(13,14)15/h1-3H,4H2,(H,13,14,15) |
| InChIKey | OMWYIBTUOBTLSW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|