C10H12N2O6 — CID 141275337
ethyl 2-(1,5-dinitrocyclohexa-2,4-dien-1-yl)acetate (PubChem CID 141275337) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is ethyl 2-(1,5-dinitrocyclohexa-2,4-dien-1-yl)acetate.
| Compound Name | ethyl 2-(1,5-dinitrocyclohexa-2,4-dien-1-yl)acetate |
|---|---|
| PubChem CID | 141275337 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | ethyl 2-(1,5-dinitrocyclohexa-2,4-dien-1-yl)acetate |
| SMILES | CCOC(=O)CC1([N+](=O)[O-])C=CC=C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C10H12N2O6/c1-2-18-9(13)7-10(12(16)17)5-3-4-8(6-10)11(14)15/h3-5H,2,6-7H2,1H3 |
| InChIKey | PVBSGDIECBLWDA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|