C10H13N5O6S — CID 152670911
ethyl N-[[(1,5-dinitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate (PubChem CID 152670911) has the molecular formula C10H13N5O6S and a molecular weight of 331.31 g/mol. Its IUPAC name is ethyl N-[[(1,5-dinitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[(1,5-dinitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 152670911 |
| Molecular Formula | C10H13N5O6S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | ethyl N-[[(1,5-dinitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)NNC1([N+](=O)[O-])C=CC=C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C10H13N5O6S/c1-2-21-9(16)11-8(22)12-13-10(15(19)20)5-3-4-7(6-10)14(17)18/h3-5,13H,2,6H2,1H3,(H2,11,12,16,22) |
| InChIKey | ZLNAMLHUVTTWGS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|