C6H5F2NO3 — CID 53420663
2,6-difluoro-6-nitrocyclohexa-2,4-dien-1-ol (PubChem CID 53420663) has the molecular formula C6H5F2NO3 and a molecular weight of 177.11 g/mol. Its IUPAC name is 2,6-difluoro-6-nitrocyclohexa-2,4-dien-1-ol.
| Compound Name | 2,6-difluoro-6-nitrocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 53420663 |
| Molecular Formula | C6H5F2NO3 |
| Molecular Weight | 177.11 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 2,6-difluoro-6-nitrocyclohexa-2,4-dien-1-ol |
| SMILES | O=[N+]([O-])C1(F)C=CC=C(F)C1O |
| InChI | InChI=1S/C6H5F2NO3/c7-4-2-1-3-6(8,5(4)10)9(11)12/h1-3,5,10H |
| InChIKey | ZNMNNXMGAVRPKL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.11 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|