C6H4F3NO3 — CID 175581784
2,5,6-trifluoro-5-nitrocyclohexa-1,3-dien-1-ol (PubChem CID 175581784) has the molecular formula C6H4F3NO3 and a molecular weight of 195.10 g/mol. Its IUPAC name is 2,5,6-trifluoro-5-nitrocyclohexa-1,3-dien-1-ol.
| Compound Name | 2,5,6-trifluoro-5-nitrocyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 175581784 |
| Molecular Formula | C6H4F3NO3 |
| Molecular Weight | 195.10 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 2,5,6-trifluoro-5-nitrocyclohexa-1,3-dien-1-ol |
| SMILES | O=[N+]([O-])C1(F)C=CC(F)=C(O)C1F |
| InChI | InChI=1S/C6H4F3NO3/c7-3-1-2-6(9,10(12)13)5(8)4(3)11/h1-2,5,11H |
| InChIKey | RSAOJXBGJDXUOM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.10 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|