C6H3F3N2O4 — CID 172555987
4,5,6-trifluoro-1,5-dinitrocyclohexa-1,3-diene (PubChem CID 172555987) has the molecular formula C6H3F3N2O4 and a molecular weight of 224.09 g/mol. Its IUPAC name is 4,5,6-trifluoro-1,5-dinitrocyclohexa-1,3-diene.
| Compound Name | 4,5,6-trifluoro-1,5-dinitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 172555987 |
| Molecular Formula | C6H3F3N2O4 |
| Molecular Weight | 224.09 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 4,5,6-trifluoro-1,5-dinitrocyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1=CC=C(F)C(F)([N+](=O)[O-])C1F |
| InChI | InChI=1S/C6H3F3N2O4/c7-4-2-1-3(10(12)13)5(8)6(4,9)11(14)15/h1-2,5H |
| InChIKey | PQZOJJKWHRWMBD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.09 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|