C7H4ClF3N2O4 — CID 150676725
5-chloro-1,3,6-trifluoro-5-methyl-2,4-dinitrocyclohexa-1,3-diene (PubChem CID 150676725) has the molecular formula C7H4ClF3N2O4 and a molecular weight of 272.57 g/mol. Its IUPAC name is 5-chloro-1,3,6-trifluoro-5-methyl-2,4-dinitrocyclohexa-1,3-diene.
| Compound Name | 5-chloro-1,3,6-trifluoro-5-methyl-2,4-dinitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 150676725 |
| Molecular Formula | C7H4ClF3N2O4 |
| Molecular Weight | 272.57 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 5-chloro-1,3,6-trifluoro-5-methyl-2,4-dinitrocyclohexa-1,3-diene |
| SMILES | CC1(Cl)C([N+](=O)[O-])=C(F)C([N+](=O)[O-])=C(F)C1F |
| InChI | InChI=1S/C7H4ClF3N2O4/c1-7(8)5(11)2(9)4(12(14)15)3(10)6(7)13(16)17/h5H,1H3 |
| InChIKey | JHASRLTWUMJOMC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|