C6H5F3N2O2 — CID 18472127
1,5,6-trifluoro-2-nitrocyclohexa-2,4-dien-1-amine (PubChem CID 18472127) has the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. Its IUPAC name is 1,5,6-trifluoro-2-nitrocyclohexa-2,4-dien-1-amine.
| Compound Name | 1,5,6-trifluoro-2-nitrocyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 18472127 |
| Molecular Formula | C6H5F3N2O2 |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 1,5,6-trifluoro-2-nitrocyclohexa-2,4-dien-1-amine |
| SMILES | NC1(F)C([N+](=O)[O-])=CC=C(F)C1F |
| InChI | InChI=1S/C6H5F3N2O2/c7-3-1-2-4(11(12)13)6(9,10)5(3)8/h1-2,5H,10H2 |
| InChIKey | ICQRGNANNKJGPK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|