C25H15NO2 — CID 69450248
2'-nitro-1,1'-spirobi[fluorene] (PubChem CID 69450248) has the molecular formula C25H15NO2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2'-nitro-1,1'-spirobi[fluorene].
| Compound Name | 2'-nitro-1,1'-spirobi[fluorene] |
|---|---|
| PubChem CID | 69450248 |
| Molecular Formula | C25H15NO2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2'-nitro-1,1'-spirobi[fluorene] |
| SMILES | O=[N+]([O-])C1=CC=C2C(=Cc3ccccc32)C12C=CC=C1C2=Cc2ccccc21 |
| InChI | InChI=1S/C25H15NO2/c27-26(28)24-12-11-21-19-9-4-2-7-17(19)15-23(21)25(24)13-5-10-20-18-8-3-1-6-16(18)14-22(20)25/h1-15H |
| InChIKey | DSQCDLOEHVLGJS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|