About 2,2'-dibromo-1,1'-spirobi[fluorene]
2,2'-dibromo-1,1'-spirobi[fluorene] (PubChem CID 68948998) has the molecular formula C25H14Br2
and a molecular weight of 474.20 g/mol. Its IUPAC name is 2,2'-dibromo-1,1'-spirobi[fluorene].
Molecular Properties
| Compound Name | 2,2'-dibromo-1,1'-spirobi[fluorene] |
| PubChem CID | 68948998 |
| Molecular Formula | C25H14Br2 |
| Molecular Weight | 474.20 g/mol |
| Exact Mass | 471.95 |
| IUPAC Name | 2,2'-dibromo-1,1'-spirobi[fluorene] |
| SMILES | BrC1=CC=C2C(=Cc3ccccc32)C12C(Br)=CC=C1C2=Cc2ccccc21 |
| InChI | InChI=1S/C25H14Br2/c26-23-11-9-19-17-7-3-1-5-15(17)13-21(19)25(23)22-14-16-6-2-4-8-18(16)20(22)10-12-24(25)27/h1-14H |
| InChIKey | MKHWJBSUJFSTRB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.20 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,2'-dibromo-1,1'-spirobi[fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2'-dibromo-1,1'-spirobi[fluorene]?
The IUPAC name of 2,2'-dibromo-1,1'-spirobi[fluorene] (CID 68948998) is 2,2'-dibromo-1,1'-spirobi[fluorene].
What is the SMILES notation for 2,2'-dibromo-1,1'-spirobi[fluorene]?
The canonical SMILES for 2,2'-dibromo-1,1'-spirobi[fluorene] is BrC1=CC=C2C(=Cc3ccccc32)C12C(Br)=CC=C1C2=Cc2ccccc21.
What is the InChIKey of 2,2'-dibromo-1,1'-spirobi[fluorene]?
The InChIKey is MKHWJBSUJFSTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H14Br2/c26-23-11-9-19-17-7-3-1-5-15(17)13-21(19)25(23)22-14-16-6-2-4-8-18(16)20(22)10-12-24(25)27/h1-14H.
What are the key properties of 2,2'-dibromo-1,1'-spirobi[fluorene]?
2,2'-dibromo-1,1'-spirobi[fluorene] has a molecular weight of 474.20 g/mol, XLogP of 7.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2'-dibromo-1,1'-spirobi[fluorene] is sourced from PubChem (CID 68948998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).