C10H15NO2 — CID 139840069
5,5,6,6-tetramethyl-1-nitrocyclohexa-1,3-diene (PubChem CID 139840069) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 5,5,6,6-tetramethyl-1-nitrocyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetramethyl-1-nitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139840069 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 5,5,6,6-tetramethyl-1-nitrocyclohexa-1,3-diene |
| SMILES | CC1(C)C=CC=C([N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C10H15NO2/c1-9(2)7-5-6-8(11(12)13)10(9,3)4/h5-7H,1-4H3 |
| InChIKey | YRLVCJWFVGOGKX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|