C24H14Cl4F2N2O5 — CID 150453958
2,5-dichloro-6-[3,6-dichloro-6-(2-fluorophenyl)-4-nitrocyclohexa-2,4-dien-1-yl]oxy-5-(2-fluorophenyl)-3-nitrocyclohexa-1,3-diene (PubChem CID 150453958) has the molecular formula C24H14Cl4F2N2O5 and a molecular weight of 590.19 g/mol. Its IUPAC name is 2,5-dichloro-6-[3,6-dichloro-6-(2-fluorophenyl)-4-nitrocyclohexa-2,4-dien-1-yl]oxy-5-(2-fluorophenyl)-3-nitrocyclohexa-1,3-diene.
| Compound Name | 2,5-dichloro-6-[3,6-dichloro-6-(2-fluorophenyl)-4-nitrocyclohexa-2,4-dien-1-yl]oxy-5-(2-fluorophenyl)-3-nitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 150453958 |
| Molecular Formula | C24H14Cl4F2N2O5 |
| Molecular Weight | 590.19 g/mol |
| Exact Mass | 587.96 |
| IUPAC Name | 2,5-dichloro-6-[3,6-dichloro-6-(2-fluorophenyl)-4-nitrocyclohexa-2,4-dien-1-yl]oxy-5-(2-fluorophenyl)-3-nitrocyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1=CC(Cl)(c2ccccc2F)C(OC2C=C(Cl)C([N+](=O)[O-])=CC2(Cl)c2ccccc2F)C=C1Cl |
| InChI | InChI=1S/C24H14Cl4F2N2O5/c25-15-9-21(23(27,11-19(15)31(33)34)13-5-1-3-7-17(13)29)37-22-10-16(26)20(32(35)36)12-24(22,28)14-6-2-4-8-18(14)30/h1-12,21-22H |
| InChIKey | HOJRIQCYAOVSIE-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.19 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|