About cyclopropanamine;1-fluoro-2-nitrobenzene
cyclopropanamine;1-fluoro-2-nitrobenzene (PubChem CID 157106778) has the molecular formula C9H11FN2O2
and a molecular weight of 198.20 g/mol. Its IUPAC name is cyclopropanamine;1-fluoro-2-nitrobenzene.
Molecular Properties
| Compound Name | cyclopropanamine;1-fluoro-2-nitrobenzene |
| PubChem CID | 157106778 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | cyclopropanamine;1-fluoro-2-nitrobenzene |
| SMILES | NC1CC1.O=[N+]([O-])c1ccccc1F |
| InChI | InChI=1S/C6H4FNO2.C3H7N/c7-5-3-1-2-4-6(5)8(9)10;4-3-1-2-3/h1-4H;3H,1-2,4H2 |
| InChIKey | AGJSYIQLRVQUAP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanamine;1-fluoro-2-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanamine;1-fluoro-2-nitrobenzene?
The IUPAC name of cyclopropanamine;1-fluoro-2-nitrobenzene (CID 157106778) is cyclopropanamine;1-fluoro-2-nitrobenzene.
What is the SMILES notation for cyclopropanamine;1-fluoro-2-nitrobenzene?
The canonical SMILES for cyclopropanamine;1-fluoro-2-nitrobenzene is NC1CC1.O=[N+]([O-])c1ccccc1F.
What is the InChIKey of cyclopropanamine;1-fluoro-2-nitrobenzene?
The InChIKey is AGJSYIQLRVQUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FNO2.C3H7N/c7-5-3-1-2-4-6(5)8(9)10;4-3-1-2-3/h1-4H;3H,1-2,4H2.
What are the key properties of cyclopropanamine;1-fluoro-2-nitrobenzene?
cyclopropanamine;1-fluoro-2-nitrobenzene has a molecular weight of 198.20 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanamine;1-fluoro-2-nitrobenzene is sourced from PubChem (CID 157106778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).