About but-1-ene;1-fluoro-2-nitrobenzene
but-1-ene;1-fluoro-2-nitrobenzene (PubChem CID 143489277) has the molecular formula C10H12FNO2
and a molecular weight of 197.21 g/mol. Its IUPAC name is but-1-ene;1-fluoro-2-nitrobenzene.
Molecular Properties
| Compound Name | but-1-ene;1-fluoro-2-nitrobenzene |
| PubChem CID | 143489277 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | but-1-ene;1-fluoro-2-nitrobenzene |
| SMILES | C=CCC.O=[N+]([O-])c1ccccc1F |
| InChI | InChI=1S/C6H4FNO2.C4H8/c7-5-3-1-2-4-6(5)8(9)10;1-3-4-2/h1-4H;3H,1,4H2,2H3 |
| InChIKey | RTWHJSYAILRWQV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;1-fluoro-2-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;1-fluoro-2-nitrobenzene?
The IUPAC name of but-1-ene;1-fluoro-2-nitrobenzene (CID 143489277) is but-1-ene;1-fluoro-2-nitrobenzene.
What is the SMILES notation for but-1-ene;1-fluoro-2-nitrobenzene?
The canonical SMILES for but-1-ene;1-fluoro-2-nitrobenzene is C=CCC.O=[N+]([O-])c1ccccc1F.
What is the InChIKey of but-1-ene;1-fluoro-2-nitrobenzene?
The InChIKey is RTWHJSYAILRWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FNO2.C4H8/c7-5-3-1-2-4-6(5)8(9)10;1-3-4-2/h1-4H;3H,1,4H2,2H3.
What are the key properties of but-1-ene;1-fluoro-2-nitrobenzene?
but-1-ene;1-fluoro-2-nitrobenzene has a molecular weight of 197.21 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;1-fluoro-2-nitrobenzene is sourced from PubChem (CID 143489277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).