About azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate
azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate (PubChem CID 88846875) has the molecular formula C6H5BF5N3O2
and a molecular weight of 256.93 g/mol. Its IUPAC name is azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate.
Molecular Properties
| Compound Name | azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate |
| PubChem CID | 88846875 |
| Molecular Formula | C6H5BF5N3O2 |
| Molecular Weight | 256.93 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[NH+].O=[N+]([O-])c1ccccc1F |
| InChI | InChI=1S/C6H4FNO2.BF4.N2/c7-5-3-1-2-4-6(5)8(9)10;2-1(3,4)5;1-2/h1-4H;;/q;-1;/p+1 |
| InChIKey | UFLPEVBDRZGFFY-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.93 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate?
The IUPAC name of azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate (CID 88846875) is azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate.
What is the SMILES notation for azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate?
The canonical SMILES for azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate is F[B-](F)(F)F.N#[NH+].O=[N+]([O-])c1ccccc1F.
What is the InChIKey of azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate?
The InChIKey is UFLPEVBDRZGFFY-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4FNO2.BF4.N2/c7-5-3-1-2-4-6(5)8(9)10;2-1(3,4)5;1-2/h1-4H;;/q;-1;/p+1.
What are the key properties of azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate?
azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate has a molecular weight of 256.93 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyneazanium;1-fluoro-2-nitrobenzene;tetrafluoroborate is sourced from PubChem (CID 88846875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).