About 2-fluoro-6-nitroaniline;hydrochloride
2-fluoro-6-nitroaniline;hydrochloride (PubChem CID 169225840) has the molecular formula C6H6ClFN2O2
and a molecular weight of 192.58 g/mol. Its IUPAC name is 2-fluoro-6-nitroaniline;hydrochloride.
Molecular Properties
| Compound Name | 2-fluoro-6-nitroaniline;hydrochloride |
| PubChem CID | 169225840 |
| Molecular Formula | C6H6ClFN2O2 |
| Molecular Weight | 192.58 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 2-fluoro-6-nitroaniline;hydrochloride |
| SMILES | Cl.Nc1c(F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5FN2O2.ClH/c7-4-2-1-3-5(6(4)8)9(10)11;/h1-3H,8H2;1H |
| InChIKey | HLGZAVXXGITDBR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.58 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-nitroaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-nitroaniline;hydrochloride?
The IUPAC name of 2-fluoro-6-nitroaniline;hydrochloride (CID 169225840) is 2-fluoro-6-nitroaniline;hydrochloride.
What is the SMILES notation for 2-fluoro-6-nitroaniline;hydrochloride?
The canonical SMILES for 2-fluoro-6-nitroaniline;hydrochloride is Cl.Nc1c(F)cccc1[N+](=O)[O-].
What is the InChIKey of 2-fluoro-6-nitroaniline;hydrochloride?
The InChIKey is HLGZAVXXGITDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2O2.ClH/c7-4-2-1-3-5(6(4)8)9(10)11;/h1-3H,8H2;1H.
What are the key properties of 2-fluoro-6-nitroaniline;hydrochloride?
2-fluoro-6-nitroaniline;hydrochloride has a molecular weight of 192.58 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-nitroaniline;hydrochloride is sourced from PubChem (CID 169225840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).