About 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline
1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline (PubChem CID 158504701) has the molecular formula C17H21FN4O2
and a molecular weight of 332.38 g/mol. Its IUPAC name is 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline.
Molecular Properties
| Compound Name | 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline |
| PubChem CID | 158504701 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline |
| SMILES | CC1CN(c2ccccc2N)CCN1.O=[N+]([O-])c1ccccc1F |
| InChI | InChI=1S/C11H17N3.C6H4FNO2/c1-9-8-14(7-6-13-9)11-5-3-2-4-10(11)12;7-5-3-1-2-4-6(5)8(9)10/h2-5,9,13H,6-8,12H2,1H3;1-4H |
| InChIKey | HKIDYKURCPHTSG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline?
The IUPAC name of 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline (CID 158504701) is 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline.
What is the SMILES notation for 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline?
The canonical SMILES for 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline is CC1CN(c2ccccc2N)CCN1.O=[N+]([O-])c1ccccc1F.
What is the InChIKey of 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline?
The InChIKey is HKIDYKURCPHTSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3.C6H4FNO2/c1-9-8-14(7-6-13-9)11-5-3-2-4-10(11)12;7-5-3-1-2-4-6(5)8(9)10/h2-5,9,13H,6-8,12H2,1H3;1-4H.
What are the key properties of 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline?
1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline has a molecular weight of 332.38 g/mol, XLogP of 2.80, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-nitrobenzene;2-(3-methylpiperazin-1-yl)aniline is sourced from PubChem (CID 158504701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).