C17H13FN2O7 — CID 86749722
[(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate (PubChem CID 86749722) has the molecular formula C17H13FN2O7 and a molecular weight of 376.30 g/mol. Its IUPAC name is [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate.
| Compound Name | [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 86749722 |
| Molecular Formula | C17H13FN2O7 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate |
| SMILES | C[C@H](OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@@]1(c2ccccc2F)CO1 |
| InChI | InChI=1S/C17H13FN2O7/c1-10(17(9-26-17)14-4-2-3-5-15(14)18)27-16(21)11-6-12(19(22)23)8-13(7-11)20(24)25/h2-8,10H,9H2,1H3/t10-,17+/m0/s1 |
| InChIKey | CAALRVSUFOWBNX-DYZYQPBXSA-N |
| XLogP | 3.11 |
| TPSA | 125.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|