About [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate
[(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate (PubChem CID 86749722) has the molecular formula C17H13FN2O7
and a molecular weight of 376.30 g/mol. Its IUPAC name is [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate.
Molecular Properties
| Compound Name | [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate |
| PubChem CID | 86749722 |
| Molecular Formula | C17H13FN2O7 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate |
| SMILES | C[C@H](OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@@]1(c2ccccc2F)CO1 |
| InChI | InChI=1S/C17H13FN2O7/c1-10(17(9-26-17)14-4-2-3-5-15(14)18)27-16(21)11-6-12(19(22)23)8-13(7-11)20(24)25/h2-8,10H,9H2,1H3/t10-,17+/m0/s1 |
| InChIKey | CAALRVSUFOWBNX-DYZYQPBXSA-N |
| XLogP | 3.11 |
| TPSA | 125.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate?
The IUPAC name of [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate (CID 86749722) is [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate.
What is the SMILES notation for [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate?
The canonical SMILES for [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate is C[C@H](OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@@]1(c2ccccc2F)CO1.
What is the InChIKey of [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate?
The InChIKey is CAALRVSUFOWBNX-DYZYQPBXSA-N. The full InChI is InChI=1S/C17H13FN2O7/c1-10(17(9-26-17)14-4-2-3-5-15(14)18)27-16(21)11-6-12(19(22)23)8-13(7-11)20(24)25/h2-8,10H,9H2,1H3/t10-,17+/m0/s1.
What are the key properties of [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate?
[(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate has a molecular weight of 376.30 g/mol, XLogP of 3.11, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-[(2R)-2-(2-fluorophenyl)oxiran-2-yl]ethyl] 3,5-dinitrobenzoate is sourced from PubChem (CID 86749722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).