C25H26N2O7 — CID 139093019
[(1R)-1-[(1R,2S,3R)-2-(cyclohexanecarbonyl)-3-phenylcyclopropyl]ethyl] 3,5-dinitrobenzoate (PubChem CID 139093019) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is [(1R)-1-[(1R,2S,3R)-2-(cyclohexanecarbonyl)-3-phenylcyclopropyl]ethyl] 3,5-dinitrobenzoate.
| Compound Name | [(1R)-1-[(1R,2S,3R)-2-(cyclohexanecarbonyl)-3-phenylcyclopropyl]ethyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139093019 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | [(1R)-1-[(1R,2S,3R)-2-(cyclohexanecarbonyl)-3-phenylcyclopropyl]ethyl] 3,5-dinitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@H]1[C@@H](C(=O)C2CCCCC2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H26N2O7/c1-15(34-25(29)18-12-19(26(30)31)14-20(13-18)27(32)33)21-22(16-8-4-2-5-9-16)23(21)24(28)17-10-6-3-7-11-17/h2,4-5,8-9,12-15,17,21-23H,3,6-7,10-11H2,1H3/t15-,21-,22-,23-/m1/s1 |
| InChIKey | OMRUFDWLYCUCJS-FNOORWRPSA-N |
| XLogP | 5.23 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|