C21H24N2O6Si — CID 139094062
[(1S,2S)-2-phenyl-1-trimethylsilylcyclopentyl] 3,5-dinitrobenzoate (PubChem CID 139094062) has the molecular formula C21H24N2O6Si and a molecular weight of 428.52 g/mol. Its IUPAC name is [(1S,2S)-2-phenyl-1-trimethylsilylcyclopentyl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,2S)-2-phenyl-1-trimethylsilylcyclopentyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139094062 |
| Molecular Formula | C21H24N2O6Si |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [(1S,2S)-2-phenyl-1-trimethylsilylcyclopentyl] 3,5-dinitrobenzoate |
| SMILES | C[Si](C)(C)[C@@]1(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24N2O6Si/c1-30(2,3)21(11-7-10-19(21)15-8-5-4-6-9-15)29-20(24)16-12-17(22(25)26)14-18(13-16)23(27)28/h4-6,8-9,12-14,19H,7,10-11H2,1-3H3/t19-,21-/m0/s1 |
| InChIKey | FDGXAFXMQLODSA-FPOVZHCZSA-N |
| XLogP | 5.24 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|