C23H20N2O9 — CID 102521061
[(3R,4S)-3-ethynyl-4-methyl-2-oxo-4-(2-phenylmethoxyethyl)oxolan-3-yl] 3,5-dinitrobenzoate (PubChem CID 102521061) has the molecular formula C23H20N2O9 and a molecular weight of 468.42 g/mol. Its IUPAC name is [(3R,4S)-3-ethynyl-4-methyl-2-oxo-4-(2-phenylmethoxyethyl)oxolan-3-yl] 3,5-dinitrobenzoate.
| Compound Name | [(3R,4S)-3-ethynyl-4-methyl-2-oxo-4-(2-phenylmethoxyethyl)oxolan-3-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 102521061 |
| Molecular Formula | C23H20N2O9 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [(3R,4S)-3-ethynyl-4-methyl-2-oxo-4-(2-phenylmethoxyethyl)oxolan-3-yl] 3,5-dinitrobenzoate |
| SMILES | C#C[C@]1(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C(=O)OC[C@]1(C)CCOCc1ccccc1 |
| InChI | InChI=1S/C23H20N2O9/c1-3-23(34-20(26)17-11-18(24(28)29)13-19(12-17)25(30)31)21(27)33-15-22(23,2)9-10-32-14-16-7-5-4-6-8-16/h1,4-8,11-13H,9-10,14-15H2,2H3/t22-,23-/m0/s1 |
| InChIKey | BMVYNGYMRCZGTC-GOTSBHOMSA-N |
| XLogP | 3.20 |
| TPSA | 148.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|