C19H19NO7 — CID 166152247
dimethyl 3-nitro-5-(2-phenylmethoxyethyl)benzene-1,2-dicarboxylate (PubChem CID 166152247) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is dimethyl 3-nitro-5-(2-phenylmethoxyethyl)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-nitro-5-(2-phenylmethoxyethyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 166152247 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | dimethyl 3-nitro-5-(2-phenylmethoxyethyl)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc(CCOCc2ccccc2)cc([N+](=O)[O-])c1C(=O)OC |
| InChI | InChI=1S/C19H19NO7/c1-25-18(21)15-10-14(8-9-27-12-13-6-4-3-5-7-13)11-16(20(23)24)17(15)19(22)26-2/h3-7,10-11H,8-9,12H2,1-2H3 |
| InChIKey | RWWAPSWEXIDKQA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|