C42H40N2O12 — CID 72823442
methyl 3,5-dinitro-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybenzoate (PubChem CID 72823442) has the molecular formula C42H40N2O12 and a molecular weight of 764.78 g/mol. Its IUPAC name is methyl 3,5-dinitro-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybenzoate.
| Compound Name | methyl 3,5-dinitro-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 72823442 |
| Molecular Formula | C42H40N2O12 |
| Molecular Weight | 764.78 g/mol |
| Exact Mass | 764.26 |
| IUPAC Name | methyl 3,5-dinitro-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C42H40N2O12/c1-50-41(45)34-22-33(43(46)47)23-35(44(48)49)37(34)56-42-40(54-27-32-20-12-5-13-21-32)39(53-26-31-18-10-4-11-19-31)38(52-25-30-16-8-3-9-17-30)36(55-42)28-51-24-29-14-6-2-7-15-29/h2-23,36,38-40,42H,24-28H2,1H3 |
| InChIKey | LPEIIBYZSISRJT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 167.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.78 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|