C22H14N4O12Te — CID 12058365
[2-(3,5-dinitrobenzoyl)oxy-1,3-dihydro-2-benzotellurophen-2-yl] 3,5-dinitrobenzoate (PubChem CID 12058365) has the molecular formula C22H14N4O12Te and a molecular weight of 653.97 g/mol. Its IUPAC name is [2-(3,5-dinitrobenzoyl)oxy-1,3-dihydro-2-benzotellurophen-2-yl] 3,5-dinitrobenzoate.
| Compound Name | [2-(3,5-dinitrobenzoyl)oxy-1,3-dihydro-2-benzotellurophen-2-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 12058365 |
| Molecular Formula | C22H14N4O12Te |
| Molecular Weight | 653.97 g/mol |
| Exact Mass | 655.97 |
| IUPAC Name | [2-(3,5-dinitrobenzoyl)oxy-1,3-dihydro-2-benzotellurophen-2-yl] 3,5-dinitrobenzoate |
| SMILES | O=C(O[Te]1(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)Cc2ccccc2C1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H14N4O12Te/c27-21(15-5-17(23(29)30)9-18(6-15)24(31)32)37-39(11-13-3-1-2-4-14(13)12-39)38-22(28)16-7-19(25(33)34)10-20(8-16)26(35)36/h1-10H,11-12H2 |
| InChIKey | RJISMCDJQCCOEG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 225.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|