C25H22N2O6 — CID 90487357
2-(5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl)propan-2-yl 3,5-dinitrobenzoate (PubChem CID 90487357) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-(5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl)propan-2-yl 3,5-dinitrobenzoate.
| Compound Name | 2-(5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl)propan-2-yl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 90487357 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-(5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl)propan-2-yl 3,5-dinitrobenzoate |
| SMILES | CC(C)(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccc2c(c1)CCCc1ccccc1-2 |
| InChI | InChI=1S/C25H22N2O6/c1-25(2,33-24(28)18-13-20(26(29)30)15-21(14-18)27(31)32)19-10-11-23-17(12-19)8-5-7-16-6-3-4-9-22(16)23/h3-4,6,9-15H,5,7-8H2,1-2H3 |
| InChIKey | ZKQLUKFPHYYNSA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|