C26H18F3NO3 — CID 174511589
[3-nitro-5-(trifluoromethyl)phenyl]-(1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 174511589) has the molecular formula C26H18F3NO3 and a molecular weight of 449.43 g/mol. Its IUPAC name is [3-nitro-5-(trifluoromethyl)phenyl]-(1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | [3-nitro-5-(trifluoromethyl)phenyl]-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 174511589 |
| Molecular Formula | C26H18F3NO3 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [3-nitro-5-(trifluoromethyl)phenyl]-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc(C(F)(F)F)c1)C1C=c2c(ccc3c2=CCc2ccccc2-3)CC1 |
| InChI | InChI=1S/C26H18F3NO3/c27-26(28,29)19-11-18(12-20(14-19)30(32)33)25(31)17-6-5-16-8-9-22-21-4-2-1-3-15(21)7-10-23(22)24(16)13-17/h1-4,8-14,17H,5-7H2 |
| InChIKey | LUZUQYYLWLMNIF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|