C29H25NO2 — CID 174525764
1H-azepine;furan-3-yl(1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 174525764) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is 1H-azepine;furan-3-yl(1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | 1H-azepine;furan-3-yl(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 174525764 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1H-azepine;furan-3-yl(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | C1=CC=CNC=C1.O=C(c1ccoc1)C1C=c2c(ccc3c2=CCc2ccccc2-3)CC1 |
| InChI | InChI=1S/C23H18O2.C6H7N/c24-23(18-11-12-25-14-18)17-6-5-16-8-9-20-19-4-2-1-3-15(19)7-10-21(20)22(16)13-17;1-2-4-6-7-5-3-1/h1-4,8-14,17H,5-7H2;1-7H |
| InChIKey | VBAFOEIXRMNDRK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |