C28H26N2O2 — CID 174511690
(6-morpholin-4-yl-3-pyridinyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 174511690) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is (6-morpholin-4-yl-3-pyridinyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | (6-morpholin-4-yl-3-pyridinyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 174511690 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (6-morpholin-4-yl-3-pyridinyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | O=C(c1ccc(N2CCOCC2)nc1)C1C=c2c(ccc3c2=CCc2ccccc2-3)CC1 |
| InChI | InChI=1S/C28H26N2O2/c31-28(22-9-12-27(29-18-22)30-13-15-32-16-14-30)21-6-5-20-8-10-24-23-4-2-1-3-19(23)7-11-25(24)26(20)17-21/h1-4,8-12,17-18,21H,5-7,13-16H2 |
| InChIKey | JVWHHXZCMIGFKP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |