C32H28BrNO — CID 175250927
1H-azepine;(2-bromo-4-methylphenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 175250927) has the molecular formula C32H28BrNO and a molecular weight of 522.49 g/mol. Its IUPAC name is 1H-azepine;(2-bromo-4-methylphenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | 1H-azepine;(2-bromo-4-methylphenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 175250927 |
| Molecular Formula | C32H28BrNO |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 1H-azepine;(2-bromo-4-methylphenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | C1=CC=CNC=C1.Cc1ccc(C(=O)C2C=c3c(ccc4c3=CCc3ccccc3-4)CC2)c(Br)c1 |
| InChI | InChI=1S/C26H21BrO.C6H7N/c1-16-6-11-23(25(27)14-16)26(28)19-8-7-18-10-12-21-20-5-3-2-4-17(20)9-13-22(21)24(18)15-19;1-2-4-6-7-5-3-1/h2-6,10-15,19H,7-9H2,1H3;1-7H |
| InChIKey | RVFSVRJOBONYCA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |