C30H26N2O — CID 174525730
1H-azepine;pyridin-3-yl(1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 174525730) has the molecular formula C30H26N2O and a molecular weight of 430.55 g/mol. Its IUPAC name is 1H-azepine;pyridin-3-yl(1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | 1H-azepine;pyridin-3-yl(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 174525730 |
| Molecular Formula | C30H26N2O |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1H-azepine;pyridin-3-yl(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | C1=CC=CNC=C1.O=C(c1cccnc1)C1C=c2c(ccc3c2=CCc2ccccc2-3)CC1 |
| InChI | InChI=1S/C24H19NO.C6H7N/c26-24(19-5-3-13-25-15-19)18-8-7-17-10-11-21-20-6-2-1-4-16(20)9-12-22(21)23(17)14-18;1-2-4-6-7-5-3-1/h1-6,10-15,18H,7-9H2;1-7H |
| InChIKey | AILZGGHVXSUKTF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |